What's in a glass of orange juice?
water, sucrose, glucose, fructose, citric acid, potassium ion, L-ascorbic acid, malic acid, pectin, limonene, myricetin, hesperidin, calcium ion, magnesium ion, sodium ion, phosphate ion, thiamin, riboflavin
| Compound | Formula | SMILES |
|---|
| water |
|
O |
| sucrose |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO)O)O)O |
| glucose |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O |
| fructose |
|
C([C@H]1[C@H]([C@H]([C@@H]([C@H](O1)O)O)O)O)O |
| citric acid |
|
C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| potassium ion |
|
[K+] |
| L-ascorbic acid |
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| malic acid |
|
C(C(C(=O)O)O)C(=O)O |
| pectin |
|
|
| limonene |
|
CC1=CCC(CC1)C(=C)C |
| myricetin |
|
C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| hesperidin |
|
CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O |
| calcium ion |
|
[Ca+2] |
| magnesium ion |
|
[Mg+2] |
| sodium ion |
|
[Na+] |
| phosphate ion |
|
O=P([O-])([O-])[O-] |
| thiamin |
|
CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO |
| riboflavin |
|
CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@H]([C@H]([C@H](CO)O)O |
source: ai · model: GPT-5 · first answered: 2026-08-09 11:04:28
Analyze a glass of orange juice live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials