What's in braised lamb shoulder?
Water, Protein, Glycine, Alanine, Valine, Leucine, Isoleucine, Serine, Threonine, Cysteine, Methionine, Aspartic acid, Glutamic acid, Asparagine, Glutamine, Lysine, Arginine, Histidine, Phenylalanine, Tyrosine, Tryptophan, Proline, Hydroxyproline, Triglycerides, Palmitic acid, Stearic acid, Oleic acid, Linoleic acid, Cholesterol, Myoglobin, Lactic acid, Succinic acid, Inosinic acid, Creatine, Glycogen, Glucose, Retinol, Thiamin, Riboflavin, Niacin, Pyridoxine, Cobalamin, Ascorbic acid, Tocopherol, Phylloquinone, Potassium ion, Sodium ion, Calcium ion, Magnesium ion, Iron ion, Zinc ion, Phosphate, Chloride, Beta-carotene, Hexanal, Nonanal, 2,4-Decadienal, Dimethyl sulfide
| Compound | Formula | SMILES |
|---|
| Water |
|
O |
| Protein |
|
|
| Glycine |
|
C(C(=O)O)N |
| Alanine |
|
C[C@@H](C(=O)O)N |
| Valine |
|
CC(C)[C@@H](C(=O)O)N |
| Leucine |
|
CC(C)C[C@@H](C(=O)O)N |
| Isoleucine |
|
CC[C@H](C)[C@@H](C(=O)O)N |
| Serine |
|
C([C@@H](C(=O)O)N)O |
| Threonine |
|
C[C@H]([C@@H](C(=O)O)N)O |
| Cysteine |
|
C([C@@H](C(=O)O)N)S |
| Methionine |
|
CSCC[C@@H](C(=O)O)N |
| Aspartic acid |
|
C([C@@H](C(=O)O)N)C(=O)O |
| Glutamic acid |
|
C(CC(=O)O)[C@@H](C(=O)O)N |
| Asparagine |
|
C([C@@H](C(=O)O)N)C(=O)N |
| Glutamine |
|
C(CC(=O)N)[C@@H](C(=O)O)N |
| Lysine |
|
C(CCN)C[C@@H](C(=O)O)N |
| Arginine |
|
C(C[C@@H](C(=O)O)N)CN=C(N)N |
| Histidine |
|
C1=C(NC=N1)C[C@@H](C(=O)O)N |
| Phenylalanine |
|
C1=CC=C(C=C1)C[C@@H](C(=O)O)N |
| Tyrosine |
|
C1=CC(=CC=C1C[C@@H](C(=O)O)N)O |
| Tryptophan |
|
C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)N |
| Proline |
|
C1C[C@H](NC1)C(=O)O |
| Hydroxyproline |
|
C1[C@H](CN[C@@H]1C(=O)O)O |
| Triglycerides |
|
|
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Stearic acid |
|
CCCCCCCCCCCCCCCCCC(=O)O |
| Oleic acid |
|
CCCCCCCC/C=C\CCCCCCCC(=O)O |
| Linoleic acid |
|
CCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| Cholesterol |
|
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Myoglobin |
|
|
| Lactic acid |
|
CC(C(=O)O)O |
| Succinic acid |
|
C(CC(=O)O)C(=O)O |
| Inosinic acid |
|
C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O |
| Creatine |
|
CN(CC(=O)O)C(=N)N |
| Glycogen |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O)CO)O)O)O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O |
| Glucose |
|
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
| Retinol |
|
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C |
| Thiamin |
|
CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO |
| Riboflavin |
|
CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
| Niacin |
|
C1=CC(=CN=C1)C(=O)O |
| Pyridoxine |
|
CC1=NC=C(C(=C1O)CO)CO |
| Cobalamin |
|
CC1=CC2=C(C=C1C)N(C=N2)[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)OP(=O)([O-])O[C@@H](C)CNC(=O)CC[C@@]\4([C@H]([C@@H]5[C@]6([C@@]([C@@H](C(=N6)/C(=C\7/[C@@]([C@@H](C(=N7)/C=C\8/C([C@@H](C(=N8)/C(=C4\[N-]5)/C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)/C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[Co+2] |
| Ascorbic acid |
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| Tocopherol |
|
CC1=C(C=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)O |
| Phylloquinone |
|
CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| Potassium ion |
|
[K+] |
| Sodium ion |
|
[Na+] |
| Calcium ion |
|
[Ca+2] |
| Magnesium ion |
|
[Mg+2] |
| Iron ion |
|
[Fe+2] |
| Zinc ion |
|
[Zn+2] |
| Phosphate |
|
[O-]P(=O)([O-])[O-] |
| Chloride |
|
[Cl-] |
| Beta-carotene |
|
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
| Hexanal |
|
CCCCCC=O |
| Nonanal |
|
CCCCCCCCC=O |
| 2,4-Decadienal |
|
CCCCC/C=C/C=C/C=O |
| Dimethyl sulfide |
|
CSC |
source: ai · model: GPT-5 · first answered: 2026-08-30 20:50:44
Analyze braised lamb shoulder live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials