What's in chocolate?
Theobromine, Caffeine, Theobromol, Fatty Acids (Stearic, Palmitic), Butterscotch Alcohol, Sorbitan Laurate, Cocoa Butter, Theobromine Alkaloid, Cocoa Shell Flavanols (Epicatechin), Tannins, Vanillic Acid, Theophylline, Magnesium Carbonate, Dairy Fat (Glycerides, Sterols), Maltodextrin, Sorbitol, Phytic Acid, Cocoa Bean Polyphenols (Epicatechin Gallate)
| Compound | Formula | SMILES |
|---|
| Theobromine |
|
CN1C=NC2=C1C(=O)NC(=O)N2C |
| Caffeine |
|
CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Theobromol |
|
|
| Fatty Acids (Stearic, Palmitic) |
|
|
| Butterscotch Alcohol |
|
|
| Sorbitan Laurate |
|
CCCCCCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
| Cocoa Butter |
|
|
| Theobromine Alkaloid |
|
|
| Cocoa Shell Flavanols (Epicatechin) |
|
|
| Tannins |
|
|
| Vanillic Acid |
|
COC1=C(C=CC(=C1)C(=O)O)O |
| Theophylline |
|
CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
| Magnesium Carbonate |
|
C(=O)([O-])[O-].[Mg+2] |
| Dairy Fat (Glycerides, Sterols) |
|
|
| Maltodextrin |
|
|
| Sorbitol |
|
C([C@H]([C@H]([C@@H]([C@H](CO)O)O)O)O)O |
| Phytic Acid |
|
C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O |
| Cocoa Bean Polyphenols (Epicatechin Gallate) |
|
|
source: ai · model: GPT-5 · first answered: 2026-09-06 14:29:00
Analyze chocolate live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials