What's in cork?
Suberin, Cellulose, Hemicellulose, Lignin, Water, Tannins, Cerotic acid, Palmitic acid, Oleic acid, Calcium oxalate
| Compound | Formula | SMILES |
|---|
| Suberin |
|
|
| Cellulose |
|
OCCOCCOc1c(O)c(O)c(O)c(O)c1O |
| Hemicellulose |
|
|
| Lignin |
|
|
| Water |
|
O |
| Tannins |
|
|
| Cerotic acid |
|
CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(O)=O)O |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(C(O)=O)O |
| Oleic acid |
|
CCCCCCCC=CCCCCCCCCCC(C(O)=O)O |
| Calcium oxalate |
|
C(O)(=O)C(=O)O.O.O.O.O.[Ca+2] |
source: ai · model: GPT-5 · first answered: 2026-07-19 11:01:38
Analyze cork live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials