What's in hemoglobin?
Hemoglobin, Water, Sodium ion, Potassium ion, Chloride ion, Phosphate, Bicarbonate, 2,3-Bisphosphoglyceric acid, Glucose, Lactic acid, Cholesterol, Palmitic acid, Stearic acid, Oleic acid, Ascorbic acid, Glutathione, Urea, Creatinine
| Compound | Formula | SMILES |
|---|
| Hemoglobin |
|
|
| Water |
|
O |
| Sodium ion |
|
[Na+] |
| Potassium ion |
|
[K+] |
| Chloride ion |
|
[Cl-] |
| Phosphate |
|
[O-]P(=O)([O-])[O-] |
| Bicarbonate |
|
C(=O)(O)[O-] |
| 2,3-Bisphosphoglyceric acid |
|
C(C(C(=O)O)OP(=O)(O)O)OP(=O)(O)O |
| Glucose |
|
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
| Lactic acid |
|
CC(C(=O)O)O |
| Cholesterol |
|
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Stearic acid |
|
CCCCCCCCCCCCCCCCCC(=O)O |
| Oleic acid |
|
CCCCCCCC/C=C\CCCCCCCC(=O)O |
| Ascorbic acid |
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| Glutathione |
|
C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |
| Urea |
|
C(=O)(N)N |
| Creatinine |
|
CN1CC(=O)N=C1N |
source: ai · model: GPT-5 · first answered: 2026-08-31 13:14:29
Analyze hemoglobin live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials