What's in marjoram 16192?
Cellulose, Water, Hemicellulose (Xylan unit), Lignin, Starch (Amylose monomer unit), Calcium ion, Potassium ion, Magnesium ion, alpha-Linolenic acid, Linoleic acid, Palmitic acid, Phosphorus (as inorganic phosphate), Iron ion, Pectin, L-Glutamic acid, L-Aspartic acid, L-Leucine, Rosmarinic acid, Ursolic acid, Oleanolic acid, Terpinen-4-ol, cis-Sabinene hydrate, gamma-Terpinene, alpha-Terpinene, Sabinene, p-Cymene, Linalool, alpha-Terpineol, beta-Caryophyllene, Chlorophyll a, Chlorophyll b, Lutein, beta-Carotene, Luteolin, Apigenin, Phylloquinone, alpha-Tocopherol, Ascorbic acid
| Compound | Formula | SMILES |
|---|
| Cellulose |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)O)O)CO)CO)O)O)O)O |
| Water |
|
O |
| Hemicellulose (Xylan unit) |
|
C1C(C(C(C(O1)O)O)O)O |
| Lignin |
|
CC(=O)NC1=C2C(=C(C=C1)S(=O)(=O)[O-])C=C(C(=C2O)N=NC3=CC=CC=C3)S(=O)(=O)[O-].[Na+].[Na+] |
| Starch (Amylose monomer unit) |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O |
| Calcium ion |
|
[Ca+2] |
| Potassium ion |
|
[K+] |
| Magnesium ion |
|
[Mg+2] |
| alpha-Linolenic acid |
|
CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O |
| Linoleic acid |
|
CCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Phosphorus (as inorganic phosphate) |
|
[O-]P(=O)([O-])[O-] |
| Iron ion |
|
[Fe+2] |
| Pectin |
|
[C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O |
| L-Glutamic acid |
|
C(CC(=O)O)[C@@H](C(=O)O)N |
| L-Aspartic acid |
|
C([C@@H](C(=O)O)N)C(=O)O |
| L-Leucine |
|
CC(C)C[C@@H](C(=O)O)N |
| Rosmarinic acid |
|
C1=CC(=C(C=C1C[C@H](C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Ursolic acid |
|
C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
| Oleanolic acid |
|
C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C)O |
| Terpinen-4-ol |
|
CC1=CCC(CC1)(C(C)C)O |
| cis-Sabinene hydrate |
|
CC(C)[C@]12CC[C@@]([C@H]1C2)(C)O |
| gamma-Terpinene |
|
CC1=CCC(=CC1)C(C)C |
| alpha-Terpinene |
|
CC1=CC=C(CC1)C(C)C |
| Sabinene |
|
CC(C)C12CCC(=C)C1C2 |
| p-Cymene |
|
CC1=CC=C(C=C1)C(C)C |
| Linalool |
|
CC(=CCCC(C)(C=C)O)C |
| alpha-Terpineol |
|
CC1=CCC(CC1)C(C)(C)O |
| beta-Caryophyllene |
|
C/C/1=C\CCC(=C)[C@H]2CC([C@@H]2CC1)(C)C |
| Chlorophyll a |
|
CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5[C@H]([C@@H](C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C4=O)C(=O)OC)C)C.[Mg+2] |
| Chlorophyll b |
|
CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5[C@H]([C@@H](C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C4=O)C(=O)OC)C)C=O.[Mg+2] |
| Lutein |
|
CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C |
| beta-Carotene |
|
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
| Luteolin |
|
C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Apigenin |
|
C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
| Phylloquinone |
|
CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| alpha-Tocopherol |
|
CC1=C(C2=C(CC[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=C1O)C)C |
| Ascorbic acid |
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
source: ai · model: GPT-5 · first answered: 2026-09-08 08:07:47
Analyze marjoram 16192 live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials