What's in marjoram 82273?
Water, Starch, Cellulose, Pectin, Sucrose, Glucose, Fructose, Protein, Alanine, Glutamic acid, Aspartic acid, Leucine, Arginine, Linoleic acid, Palmitic acid, Oleic acid, Stearic acid, Triglycerides, Rosmarinic acid, Chlorogenic acid, Quercetin, Luteolin, Carnosic acid, Ursolic acid, Beta-sitosterol, Ascorbic acid, Alpha-tocopherol, Thiamin, Riboflavin, Niacin, Folate, Potassium ion, Calcium ion, Magnesium ion, Phosphate, Sodium ion, Iron ion, Zinc ion, Manganese ion, Chlorophyll a, Beta-carotene, Lutein, Cis-sabinene hydrate, Terpinen-4-ol, Trans-sabinene hydrate, Alpha-terpineol, Linalool, Caryophyllene, Humulene, Eucalyptol
| Compound | Formula | SMILES |
|---|
| Water |
|
O |
| Starch |
|
|
| Cellulose |
|
|
| Pectin |
|
[C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O |
| Sucrose |
|
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO)O)O)O)O |
| Glucose |
|
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
| Fructose |
|
C1[C@H]([C@H]([C@@H](C(O1)(CO)O)O)O)O |
| Protein |
|
|
| Alanine |
|
C[C@@H](C(=O)O)N |
| Glutamic acid |
|
C(CC(=O)O)[C@@H](C(=O)O)N |
| Aspartic acid |
|
C([C@@H](C(=O)O)N)C(=O)O |
| Leucine |
|
CC(C)C[C@@H](C(=O)O)N |
| Arginine |
|
C(C[C@@H](C(=O)O)N)CN=C(N)N |
| Linoleic acid |
|
CCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Oleic acid |
|
CCCCCCCC/C=C\CCCCCCCC(=O)O |
| Stearic acid |
|
CCCCCCCCCCCCCCCCCC(=O)O |
| Triglycerides |
|
|
| Rosmarinic acid |
|
C1=CC(=C(C=C1C[C@H](C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Chlorogenic acid |
|
C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Quercetin |
|
C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Luteolin |
|
C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Carnosic acid |
|
CC(C)C1=C(C(=C2C(=C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)O |
| Ursolic acid |
|
C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
| Beta-sitosterol |
|
CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |
| Ascorbic acid |
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| Alpha-tocopherol |
|
CC1=C(C2=C(CC[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=C1O)C)C |
| Thiamin |
|
CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO |
| Riboflavin |
|
CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
| Niacin |
|
C1=CC(=CN=C1)C(=O)O |
| Folate |
|
C1=CC(=CC=C1C(=O)N[C@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
| Potassium ion |
|
[K+] |
| Calcium ion |
|
[Ca+2] |
| Magnesium ion |
|
[Mg+2] |
| Phosphate |
|
[O-]P(=O)([O-])[O-] |
| Sodium ion |
|
[Na+] |
| Iron ion |
|
[Fe+2] |
| Zinc ion |
|
[Zn+2] |
| Manganese ion |
|
[Mn+2] |
| Chlorophyll a |
|
CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5[C@H]([C@@H](C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C4=O)C(=O)OC)C)C.[Mg+2] |
| Beta-carotene |
|
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
| Lutein |
|
CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C |
| Cis-sabinene hydrate |
|
CC(C)[C@]12CC[C@@]([C@H]1C2)(C)O |
| Terpinen-4-ol |
|
CC1=CCC(CC1)(C(C)C)O |
| Trans-sabinene hydrate |
|
CC(C)[C@@]12CC[C@@]([C@@H]1C2)(C)O |
| Alpha-terpineol |
|
CC1=CCC(CC1)C(C)(C)O |
| Linalool |
|
CC(=CCCC(C)(C=C)O)C |
| Caryophyllene |
|
C/C/1=C\CCC(=C)[C@H]2CC([C@@H]2CC1)(C)C |
| Humulene |
|
C/C/1=C\CC(/C=C/C/C(=C/CC1)/C)(C)C |
| Eucalyptol |
|
CC1(C2CCC(O1)(CC2)C)C |
source: ai · model: GPT-5 · first answered: 2026-09-08 19:21:30
Analyze marjoram 82273 live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials