What's in Red circle?
Iron(III) oxide, Water, Cellulose, Glucose, Sucrose, Starch, Glycine, L-Alanine, L-Glutamic acid, Palmitic acid, Oleic acid, Cholesterol, Citric acid, Ascorbic acid, beta-Carotene, Lycopene, Quercetin, Anthocyanin, Calcium ion, Potassium ion, Sodium ion
| Compound | Formula | SMILES |
|---|
| Iron(III) oxide |
|
O=[Fe]O[Fe]=O |
| Water |
|
O |
| Cellulose |
|
|
| Glucose |
|
OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| Sucrose |
|
OC[C@H]1O[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| Starch |
|
|
| Glycine |
|
NCC(=O)O |
| L-Alanine |
|
C[C@H](N)C(=O)O |
| L-Glutamic acid |
|
N[C@@H](CCC(=O)O)C(=O)O |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Oleic acid |
|
CCCCCCCC/C=C\CCCCCCCC(=O)O |
| Cholesterol |
|
CC[C@H]1[C@@H](O)CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@H]3CC=C12 |
| Citric acid |
|
OC(=O)CC(O)(CC(=O)O)C(=O)O |
| Ascorbic acid |
|
OC1=C(O)C(=O)OC1[C@H](O)CO |
| beta-Carotene |
|
CC1=C(C)C(C)(C)C/C(=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C1 |
| Lycopene |
|
CC(=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CC=C(C)C)C=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| Quercetin |
|
Oc1cc(O)c2c(c1)oc(-c1cc(O)c(O)c(O)c1)c(O)c2=O |
| Anthocyanin |
|
|
| Calcium ion |
|
|
| Potassium ion |
|
|
| Sodium ion |
|
|
source: ai-vision · first answered: 2026-08-29 16:25:16
Analyze Red circle live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials