What's in Send email?
Silicon dioxide, Aluminum oxide, Iron oxide, Water, Sodium chloride, Cellulose, Polyethylene terephthalate, Epoxy resin
| Compound | Formula | SMILES |
|---|
| Silicon dioxide |
|
O=[Si]=O |
| Aluminum oxide |
|
[O-2].[O-2].[O-2].[Al+3].[Al+3] |
| Iron oxide |
|
O=[Fe]=O |
| Water |
|
O |
| Sodium chloride |
|
[Na+].[Cl-] |
| Cellulose |
|
|
| Polyethylene terephthalate |
|
|
| Epoxy resin |
|
CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C=CC(=O)O.C1C(O1)CCl |
source: ai · model: GPT-5 · first answered: 2026-09-14 17:46:46
Analyze Send email live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials