What's in steak?
Water, Oleic acid, Palmitic acid, Stearic acid, Potassium ion, Lactic acid, Carnosine, Creatine, Linoleic acid, Phosphatidylcholine, Sodium ion, Phosphate, L-Glutamic acid, L-Alanine, L-Carnitine, Inosine monophosphate, Cholesterol, Taurine, Magnesium ion, Anserine, Heme b, Glycine, L-Leucine, L-Lysine, L-Valine, L-Arginine, Arachidonic acid, Calcium ion, Zinc ion, Hypoxanthine, Nicotinamide, alpha-Tocopherol, Hexanal, Octanal, Dimethyl sulfide, Cyanocobalamin
| Compound | Formula | SMILES |
|---|
| Water |
|
O |
| Oleic acid |
|
CCCCCCCC/C=C\CCCCCCCC(=O)O |
| Palmitic acid |
|
CCCCCCCCCCCCCCCC(=O)O |
| Stearic acid |
|
CCCCCCCCCCCCCCCCCC(=O)O |
| Potassium ion |
|
[K+] |
| Lactic acid |
|
CC(C(=O)O)O |
| Carnosine |
|
C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)CCN |
| Creatine |
|
CN(CC(=O)O)C(=N)N |
| Linoleic acid |
|
CCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| Phosphatidylcholine |
|
|
| Sodium ion |
|
[Na+] |
| Phosphate |
|
[O-]P(=O)([O-])[O-] |
| L-Glutamic acid |
|
C(CC(=O)O)[C@@H](C(=O)O)N |
| L-Alanine |
|
C[C@@H](C(=O)O)N |
| L-Carnitine |
|
C[N+](C)(C)C[C@@H](CC(=O)[O-])O |
| Inosine monophosphate |
|
C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O |
| Cholesterol |
|
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Taurine |
|
C(CS(=O)(=O)O)N |
| Magnesium ion |
|
[Mg+2] |
| Anserine |
|
CN1C=NC=C1C[C@@H](C(=O)O)NC(=O)CCN |
| Heme b |
|
CC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.[Fe+2] |
| Glycine |
|
C(C(=O)O)N |
| L-Leucine |
|
CC(C)C[C@@H](C(=O)O)N |
| L-Lysine |
|
C(CCN)C[C@@H](C(=O)O)N |
| L-Valine |
|
CC(C)[C@@H](C(=O)O)N |
| L-Arginine |
|
C(C[C@@H](C(=O)O)N)CN=C(N)N |
| Arachidonic acid |
|
CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| Calcium ion |
|
[Ca+2] |
| Zinc ion |
|
[Zn+2] |
| Hypoxanthine |
|
C1=NC2=C(N1)C(=O)N=CN2 |
| Nicotinamide |
|
C1=CC(=CN=C1)C(=O)N |
| alpha-Tocopherol |
|
CC1=C(C2=C(CC[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=C1O)C)C |
| Hexanal |
|
CCCCCC=O |
| Octanal |
|
CCCCCCCC=O |
| Dimethyl sulfide |
|
CSC |
| Cyanocobalamin |
|
CC1=CC2=C(C=C1C)[N+](=CN2)[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)OP(=O)(O)O[C@H](C)CNC(=O)CC[C@@]4([C@H]([C@@H]5[C@]6([C@@]([C@@H](C(=N6)/C(=C\7/[C@@]([C@@H](/C(=C/C8=N/C(=C(\C4=N5)/C)/[C@H](C8(C)C)CCC(=N)[O-])/N7)CCC(=N)[O-])(C)CC(=O)N)/C)CCC(=N)[O-])(C)CC(=O)N)C)CC(=O)N)C)O.[C]#N.[Co+2] |
source: ai · model: GPT-5 · first answered: 2026-09-06 14:30:22
Analyze steak live — 3D molecules →
FYZX — identify and visualize the molecular composition of any object. All materials